C17H22N3O3S+ — CID 87597441
4-[3-(N-anilino-C-methylcarbonimidoyl)pyridin-1-ium-1-yl]butane-1-sulfonic acid (PubChem CID 87597441) has the molecular formula C17H22N3O3S+ and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-[3-(N-anilino-C-methylcarbonimidoyl)pyridin-1-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[3-(N-anilino-C-methylcarbonimidoyl)pyridin-1-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87597441 |
| Molecular Formula | C17H22N3O3S+ |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 4-[3-(N-anilino-C-methylcarbonimidoyl)pyridin-1-ium-1-yl]butane-1-sulfonic acid |
| SMILES | CC(=NNc1ccccc1)c1ccc[n+](CCCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C17H21N3O3S/c1-15(18-19-17-9-3-2-4-10-17)16-8-7-12-20(14-16)11-5-6-13-24(21,22)23/h2-4,7-10,12,14,19H,5-6,11,13H2,1H3/p+1 |
| InChIKey | UDUFPTZICZFDII-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 82.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|