C19H20B2F8N2 — CID 11525231
1-methyl-4-[1-(2-phenylethyl)pyridin-1-ium-4-yl]pyridin-1-ium ditetrafluoroborate (PubChem CID 11525231) has the molecular formula C19H20B2F8N2 and a molecular weight of 449.99 g/mol. Its IUPAC name is 1-methyl-4-[1-(2-phenylethyl)pyridin-1-ium-4-yl]pyridin-1-ium ditetrafluoroborate.
| Compound Name | 1-methyl-4-[1-(2-phenylethyl)pyridin-1-ium-4-yl]pyridin-1-ium ditetrafluoroborate |
|---|---|
| PubChem CID | 11525231 |
| Molecular Formula | C19H20B2F8N2 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 1-methyl-4-[1-(2-phenylethyl)pyridin-1-ium-4-yl]pyridin-1-ium ditetrafluoroborate |
| SMILES | C[n+]1ccc(-c2cc[n+](CCc3ccccc3)cc2)cc1.F[B-](F)(F)F.F[B-](F)(F)F |
| InChI | InChI=1S/C19H20N2.2BF4/c1-20-12-8-18(9-13-20)19-10-15-21(16-11-19)14-7-17-5-3-2-4-6-17;2*2-1(3,4)5/h2-6,8-13,15-16H,7,14H2,1H3;;/q+2;2*-1 |
| InChIKey | NZLIXQYVSHICHX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|