C34H38O6 — CID 23147397
2-[2-[2-(3,4-dimethoxyphenyl)-6-ethyl-3,5-bis(phenylmethoxy)phenyl]ethoxy]ethanol (PubChem CID 23147397) has the molecular formula C34H38O6 and a molecular weight of 542.67 g/mol. Its IUPAC name is 2-[2-[2-(3,4-dimethoxyphenyl)-6-ethyl-3,5-bis(phenylmethoxy)phenyl]ethoxy]ethanol.
| Compound Name | 2-[2-[2-(3,4-dimethoxyphenyl)-6-ethyl-3,5-bis(phenylmethoxy)phenyl]ethoxy]ethanol |
|---|---|
| PubChem CID | 23147397 |
| Molecular Formula | C34H38O6 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 2-[2-[2-(3,4-dimethoxyphenyl)-6-ethyl-3,5-bis(phenylmethoxy)phenyl]ethoxy]ethanol |
| SMILES | CCc1c(OCc2ccccc2)cc(OCc2ccccc2)c(-c2ccc(OC)c(OC)c2)c1CCOCCO |
| InChI | InChI=1S/C34H38O6/c1-4-28-29(17-19-38-20-18-35)34(27-15-16-30(36-2)32(21-27)37-3)33(40-24-26-13-9-6-10-14-26)22-31(28)39-23-25-11-7-5-8-12-25/h5-16,21-22,35H,4,17-20,23-24H2,1-3H3 |
| InChIKey | XRSCOUDLCGWBHU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|