C22H34O6 — CID 145133787
ethanol;1-ethoxy-4-ethyl-2-methoxybenzene;2-(2-methoxyphenoxy)ethanol (PubChem CID 145133787) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is ethanol;1-ethoxy-4-ethyl-2-methoxybenzene;2-(2-methoxyphenoxy)ethanol.
| Compound Name | ethanol;1-ethoxy-4-ethyl-2-methoxybenzene;2-(2-methoxyphenoxy)ethanol |
|---|---|
| PubChem CID | 145133787 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | ethanol;1-ethoxy-4-ethyl-2-methoxybenzene;2-(2-methoxyphenoxy)ethanol |
| SMILES | CCO.CCOc1ccc(CC)cc1OC.COc1ccccc1OCCO |
| InChI | InChI=1S/C11H16O2.C9H12O3.C2H6O/c1-4-9-6-7-10(13-5-2)11(8-9)12-3;1-11-8-4-2-3-5-9(8)12-7-6-10;1-2-3/h6-8H,4-5H2,1-3H3;2-5,10H,6-7H2,1H3;3H,2H2,1H3 |
| InChIKey | RATQOSOUUQNLIG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |