C22H46O3 — CID 143005011
3,3-dimethylbutan-1-ol;ethane;4-ethyl-1,2-dimethoxybenzene (PubChem CID 143005011) has the molecular formula C22H46O3 and a molecular weight of 358.61 g/mol. Its IUPAC name is 3,3-dimethylbutan-1-ol;ethane;4-ethyl-1,2-dimethoxybenzene.
| Compound Name | 3,3-dimethylbutan-1-ol;ethane;4-ethyl-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 143005011 |
| Molecular Formula | C22H46O3 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.34 |
| IUPAC Name | 3,3-dimethylbutan-1-ol;ethane;4-ethyl-1,2-dimethoxybenzene |
| SMILES | CC.CC.CC.CC(C)(C)CCO.CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C10H14O2.C6H14O.3C2H6/c1-4-8-5-6-9(11-2)10(7-8)12-3;1-6(2,3)4-5-7;3*1-2/h5-7H,4H2,1-3H3;7H,4-5H2,1-3H3;3*1-2H3 |
| InChIKey | DABOSGJLYAXXCY-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |