C12H16F2O2 — CID 116841028
3-(5-ethyl-2-methoxyphenyl)-3,3-difluoropropan-1-ol (PubChem CID 116841028) has the molecular formula C12H16F2O2 and a molecular weight of 230.25 g/mol. Its IUPAC name is 3-(5-ethyl-2-methoxyphenyl)-3,3-difluoropropan-1-ol.
| Compound Name | 3-(5-ethyl-2-methoxyphenyl)-3,3-difluoropropan-1-ol |
|---|---|
| PubChem CID | 116841028 |
| Molecular Formula | C12H16F2O2 |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 3-(5-ethyl-2-methoxyphenyl)-3,3-difluoropropan-1-ol |
| SMILES | CCc1ccc(OC)c(C(F)(F)CCO)c1 |
| InChI | InChI=1S/C12H16F2O2/c1-3-9-4-5-11(16-2)10(8-9)12(13,14)6-7-15/h4-5,8,15H,3,6-7H2,1-2H3 |
| InChIKey | XLKMEQRBKBRXAB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |