C14H22O2 — CID 94258956
3-(5-ethyl-2-methoxyphenyl)-2,2-dimethylpropan-1-ol (PubChem CID 94258956) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 3-(5-ethyl-2-methoxyphenyl)-2,2-dimethylpropan-1-ol.
| Compound Name | 3-(5-ethyl-2-methoxyphenyl)-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 94258956 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 3-(5-ethyl-2-methoxyphenyl)-2,2-dimethylpropan-1-ol |
| SMILES | CCc1ccc(OC)c(CC(C)(C)CO)c1 |
| InChI | InChI=1S/C14H22O2/c1-5-11-6-7-13(16-4)12(8-11)9-14(2,3)10-15/h6-8,15H,5,9-10H2,1-4H3 |
| InChIKey | IANWOHFPEWJPCL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |