C15H24O5 — CID 16736187
(3R)-5-[(3,4-dimethoxyphenyl)methoxy]-3-methylpentane-1,3-diol (PubChem CID 16736187) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (3R)-5-[(3,4-dimethoxyphenyl)methoxy]-3-methylpentane-1,3-diol.
| Compound Name | (3R)-5-[(3,4-dimethoxyphenyl)methoxy]-3-methylpentane-1,3-diol |
|---|---|
| PubChem CID | 16736187 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (3R)-5-[(3,4-dimethoxyphenyl)methoxy]-3-methylpentane-1,3-diol |
| SMILES | COc1ccc(COCC[C@](C)(O)CCO)cc1OC |
| InChI | InChI=1S/C15H24O5/c1-15(17,6-8-16)7-9-20-11-12-4-5-13(18-2)14(10-12)19-3/h4-5,10,16-17H,6-9,11H2,1-3H3/t15-/m1/s1 |
| InChIKey | AJVHTOFYJRLZLC-OAHLLOKOSA-N |
| XLogP | 1.74 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|