C15H24O4 — CID 114852238
1-(3,4-dimethoxyphenyl)-5-methoxy-2-methylpentan-2-ol (PubChem CID 114852238) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-5-methoxy-2-methylpentan-2-ol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-5-methoxy-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 114852238 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-5-methoxy-2-methylpentan-2-ol |
| SMILES | COCCCC(C)(O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H24O4/c1-15(16,8-5-9-17-2)11-12-6-7-13(18-3)14(10-12)19-4/h6-7,10,16H,5,8-9,11H2,1-4H3 |
| InChIKey | FQKWUDLTAGSYGI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|