C17H26N2O6 — CID 122022063
4-[[3-(3,4-dimethoxyphenyl)-2-hydroxy-2-methylpropyl]carbamoylamino]butanoic acid (PubChem CID 122022063) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is 4-[[3-(3,4-dimethoxyphenyl)-2-hydroxy-2-methylpropyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[3-(3,4-dimethoxyphenyl)-2-hydroxy-2-methylpropyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122022063 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-[[3-(3,4-dimethoxyphenyl)-2-hydroxy-2-methylpropyl]carbamoylamino]butanoic acid |
| SMILES | COc1ccc(CC(C)(O)CNC(=O)NCCCC(=O)O)cc1OC |
| InChI | InChI=1S/C17H26N2O6/c1-17(23,11-19-16(22)18-8-4-5-15(20)21)10-12-6-7-13(24-2)14(9-12)25-3/h6-7,9,23H,4-5,8,10-11H2,1-3H3,(H,20,21)(H2,18,19,22) |
| InChIKey | SRZDGAKPWWWQKK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|