C15H23NO4 — CID 65233704
4-(3,4-dimethoxyphenyl)-3-(ethylamino)-3-methylbutanoic acid (PubChem CID 65233704) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-3-(ethylamino)-3-methylbutanoic acid.
| Compound Name | 4-(3,4-dimethoxyphenyl)-3-(ethylamino)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 65233704 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-3-(ethylamino)-3-methylbutanoic acid |
| SMILES | CCNC(C)(CC(=O)O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H23NO4/c1-5-16-15(2,10-14(17)18)9-11-6-7-12(19-3)13(8-11)20-4/h6-8,16H,5,9-10H2,1-4H3,(H,17,18) |
| InChIKey | HQRUWFGSACATFR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |