C17H29NO3 — CID 135313299
1-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2,3-dimethylbutan-2-amine (PubChem CID 135313299) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is 1-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2,3-dimethylbutan-2-amine.
| Compound Name | 1-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 135313299 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-[4-methoxy-3-(3-methoxypropoxy)phenyl]-2,3-dimethylbutan-2-amine |
| SMILES | COCCCOc1cc(CC(C)(N)C(C)C)ccc1OC |
| InChI | InChI=1S/C17H29NO3/c1-13(2)17(3,18)12-14-7-8-15(20-5)16(11-14)21-10-6-9-19-4/h7-8,11,13H,6,9-10,12,18H2,1-5H3 |
| InChIKey | DQCIKKGZDMKKAC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|