C12H15BrF2O3 — CID 107140181
1-bromo-3-(3,4-dimethoxyphenyl)-1,1-difluoro-2-methylpropan-2-ol (PubChem CID 107140181) has the molecular formula C12H15BrF2O3 and a molecular weight of 325.15 g/mol. Its IUPAC name is 1-bromo-3-(3,4-dimethoxyphenyl)-1,1-difluoro-2-methylpropan-2-ol.
| Compound Name | 1-bromo-3-(3,4-dimethoxyphenyl)-1,1-difluoro-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 107140181 |
| Molecular Formula | C12H15BrF2O3 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 1-bromo-3-(3,4-dimethoxyphenyl)-1,1-difluoro-2-methylpropan-2-ol |
| SMILES | COc1ccc(CC(C)(O)C(F)(F)Br)cc1OC |
| InChI | InChI=1S/C12H15BrF2O3/c1-11(16,12(13,14)15)7-8-4-5-9(17-2)10(6-8)18-3/h4-6,16H,7H2,1-3H3 |
| InChIKey | NWQLNGDXXUNTLH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|