C27H38O7 — CID 23147278
2-[2-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethoxy]ethoxy]oxane (PubChem CID 23147278) has the molecular formula C27H38O7 and a molecular weight of 474.59 g/mol. Its IUPAC name is 2-[2-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethoxy]ethoxy]oxane.
| Compound Name | 2-[2-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethoxy]ethoxy]oxane |
|---|---|
| PubChem CID | 23147278 |
| Molecular Formula | C27H38O7 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 2-[2-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethoxy]ethoxy]oxane |
| SMILES | CCc1c(OCOC)cc(OCOC)c(-c2ccccc2)c1CCOCCOC1CCCCO1 |
| InChI | InChI=1S/C27H38O7/c1-4-22-23(13-15-30-16-17-32-26-12-8-9-14-31-26)27(21-10-6-5-7-11-21)25(34-20-29-3)18-24(22)33-19-28-2/h5-7,10-11,18,26H,4,8-9,12-17,19-20H2,1-3H3 |
| InChIKey | FTGAQGURFCPPIR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|