C22H29NO6 — CID 23147052
2-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethoxy]acetamide (PubChem CID 23147052) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethoxy]acetamide.
| Compound Name | 2-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethoxy]acetamide |
|---|---|
| PubChem CID | 23147052 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethoxy]acetamide |
| SMILES | CCc1c(OCOC)cc(OCOC)c(-c2ccccc2)c1CCOCC(N)=O |
| InChI | InChI=1S/C22H29NO6/c1-4-17-18(10-11-27-13-21(23)24)22(16-8-6-5-7-9-16)20(29-15-26-3)12-19(17)28-14-25-2/h5-9,12H,4,10-11,13-15H2,1-3H3,(H2,23,24) |
| InChIKey | MFFOAQAHAVGUFX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|