2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid

C20H24O6 — CID 23147060

IUPAC2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid
SMILESCCC(C(=O)O)c1cc(OCOC)cc(OCOC)c1-c1ccccc1
InChIInChI=1S/C20H24O6/c1-4-16(20(21)22)17-10-15(25-12-23-2)11-18(26-13-24-3)19(17)14-8-6-5-7-9-14/h5-11,16H,4,12-13H2,1-3H3,(H,21,22)
InChIKeyLVIMWESQVMIOTR-UHFFFAOYSA-N
MW360.41 g/mol
LogP3.90
Rot. Bonds10

About 2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid

2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid (PubChem CID 23147060) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid.

Molecular Properties

Compound Name2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid
PubChem CID23147060
Molecular FormulaC20H24O6
Molecular Weight360.41 g/mol
Exact Mass360.16
IUPAC Name2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid
SMILESCCC(C(=O)O)c1cc(OCOC)cc(OCOC)c1-c1ccccc1
InChIInChI=1S/C20H24O6/c1-4-16(20(21)22)17-10-15(25-12-23-2)11-18(26-13-24-3)19(17)14-8-6-5-7-9-14/h5-11,16H,4,12-13H2,1-3H3,(H,21,22)
InChIKeyLVIMWESQVMIOTR-UHFFFAOYSA-N
XLogP3.90
TPSA74.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds10
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500360.41
LogP ≤ 53.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid?
The IUPAC name of 2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid (CID 23147060) is 2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid.
What is the SMILES notation for 2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid?
The canonical SMILES for 2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid is CCC(C(=O)O)c1cc(OCOC)cc(OCOC)c1-c1ccccc1.
What is the InChIKey of 2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid?
The InChIKey is LVIMWESQVMIOTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O6/c1-4-16(20(21)22)17-10-15(25-12-23-2)11-18(26-13-24-3)19(17)14-8-6-5-7-9-14/h5-11,16H,4,12-13H2,1-3H3,(H,21,22).
What are the key properties of 2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid?
2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid has a molecular weight of 360.41 g/mol, XLogP of 3.90, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(methoxymethoxy)-2-phenylphenyl]butanoic acid is sourced from PubChem (CID 23147060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).