C23H28O7 — CID 69024587
methyl 2-[3,5-bis(methoxymethoxy)-2-[3-(3-oxobutyl)phenyl]phenyl]acetate (PubChem CID 69024587) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is methyl 2-[3,5-bis(methoxymethoxy)-2-[3-(3-oxobutyl)phenyl]phenyl]acetate.
| Compound Name | methyl 2-[3,5-bis(methoxymethoxy)-2-[3-(3-oxobutyl)phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 69024587 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | methyl 2-[3,5-bis(methoxymethoxy)-2-[3-(3-oxobutyl)phenyl]phenyl]acetate |
| SMILES | COCOc1cc(CC(=O)OC)c(-c2cccc(CCC(C)=O)c2)c(OCOC)c1 |
| InChI | InChI=1S/C23H28O7/c1-16(24)8-9-17-6-5-7-18(10-17)23-19(12-22(25)28-4)11-20(29-14-26-2)13-21(23)30-15-27-3/h5-7,10-11,13H,8-9,12,14-15H2,1-4H3 |
| InChIKey | IWDVBGOBAVAROY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|