C26H27FO5 — CID 157404165
2-[2-fluoro-4-[2-[3-[4-(methoxymethoxy)-2,6-dimethylphenyl]phenyl]ethyl]phenoxy]acetic acid (PubChem CID 157404165) has the molecular formula C26H27FO5 and a molecular weight of 438.50 g/mol. Its IUPAC name is 2-[2-fluoro-4-[2-[3-[4-(methoxymethoxy)-2,6-dimethylphenyl]phenyl]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-fluoro-4-[2-[3-[4-(methoxymethoxy)-2,6-dimethylphenyl]phenyl]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 157404165 |
| Molecular Formula | C26H27FO5 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-[2-fluoro-4-[2-[3-[4-(methoxymethoxy)-2,6-dimethylphenyl]phenyl]ethyl]phenoxy]acetic acid |
| SMILES | COCOc1cc(C)c(-c2cccc(CCc3ccc(OCC(=O)O)c(F)c3)c2)c(C)c1 |
| InChI | InChI=1S/C26H27FO5/c1-17-11-22(32-16-30-3)12-18(2)26(17)21-6-4-5-19(13-21)7-8-20-9-10-24(23(27)14-20)31-15-25(28)29/h4-6,9-14H,7-8,15-16H2,1-3H3,(H,28,29) |
| InChIKey | BNNHEXIEFNTVAY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|