C25H26O6 — CID 23146916
methyl 2-[3,5-bis(methoxymethoxy)-2-(4-phenylphenyl)phenyl]acetate (PubChem CID 23146916) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is methyl 2-[3,5-bis(methoxymethoxy)-2-(4-phenylphenyl)phenyl]acetate.
| Compound Name | methyl 2-[3,5-bis(methoxymethoxy)-2-(4-phenylphenyl)phenyl]acetate |
|---|---|
| PubChem CID | 23146916 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | methyl 2-[3,5-bis(methoxymethoxy)-2-(4-phenylphenyl)phenyl]acetate |
| SMILES | COCOc1cc(CC(=O)OC)c(-c2ccc(-c3ccccc3)cc2)c(OCOC)c1 |
| InChI | InChI=1S/C25H26O6/c1-27-16-30-22-13-21(14-24(26)29-3)25(23(15-22)31-17-28-2)20-11-9-19(10-12-20)18-7-5-4-6-8-18/h4-13,15H,14,16-17H2,1-3H3 |
| InChIKey | JNBAROQJODNSMZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|