C17H18O8 — CID 90814335
2-[2-(5-formylfuran-2-yl)-3,5-bis(methoxymethoxy)phenyl]acetic acid (PubChem CID 90814335) has the molecular formula C17H18O8 and a molecular weight of 350.32 g/mol. Its IUPAC name is 2-[2-(5-formylfuran-2-yl)-3,5-bis(methoxymethoxy)phenyl]acetic acid.
| Compound Name | 2-[2-(5-formylfuran-2-yl)-3,5-bis(methoxymethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 90814335 |
| Molecular Formula | C17H18O8 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-[2-(5-formylfuran-2-yl)-3,5-bis(methoxymethoxy)phenyl]acetic acid |
| SMILES | COCOc1cc(CC(=O)O)c(-c2ccc(C=O)o2)c(OCOC)c1 |
| InChI | InChI=1S/C17H18O8/c1-21-9-23-13-5-11(6-16(19)20)17(15(7-13)24-10-22-2)14-4-3-12(8-18)25-14/h3-5,7-8H,6,9-10H2,1-2H3,(H,19,20) |
| InChIKey | WVEWYNCOOYOQQC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|