C21H23BrO9 — CID 23147279
methyl (E)-3-[5-[3-bromo-4,6-bis(methoxymethoxy)-2-(2-methoxy-2-oxoethyl)phenyl]furan-2-yl]prop-2-enoate (PubChem CID 23147279) has the molecular formula C21H23BrO9 and a molecular weight of 499.31 g/mol. Its IUPAC name is methyl (E)-3-[5-[3-bromo-4,6-bis(methoxymethoxy)-2-(2-methoxy-2-oxoethyl)phenyl]furan-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[5-[3-bromo-4,6-bis(methoxymethoxy)-2-(2-methoxy-2-oxoethyl)phenyl]furan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 23147279 |
| Molecular Formula | C21H23BrO9 |
| Molecular Weight | 499.31 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | methyl (E)-3-[5-[3-bromo-4,6-bis(methoxymethoxy)-2-(2-methoxy-2-oxoethyl)phenyl]furan-2-yl]prop-2-enoate |
| SMILES | COCOc1cc(OCOC)c(-c2ccc(/C=C/C(=O)OC)o2)c(CC(=O)OC)c1Br |
| InChI | InChI=1S/C21H23BrO9/c1-25-11-29-16-10-17(30-12-26-2)21(22)14(9-19(24)28-4)20(16)15-7-5-13(31-15)6-8-18(23)27-3/h5-8,10H,9,11-12H2,1-4H3/b8-6+ |
| InChIKey | YNDSFWDEMXRNSM-SOFGYWHQSA-N |
| XLogP | 3.58 |
| TPSA | 102.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.31 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|