C19H20O7 — CID 91323434
2-[2-(3-formylphenyl)-3,5-bis(methoxymethoxy)phenyl]acetic acid (PubChem CID 91323434) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is 2-[2-(3-formylphenyl)-3,5-bis(methoxymethoxy)phenyl]acetic acid.
| Compound Name | 2-[2-(3-formylphenyl)-3,5-bis(methoxymethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 91323434 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-[2-(3-formylphenyl)-3,5-bis(methoxymethoxy)phenyl]acetic acid |
| SMILES | COCOc1cc(CC(=O)O)c(-c2cccc(C=O)c2)c(OCOC)c1 |
| InChI | InChI=1S/C19H20O7/c1-23-11-25-16-7-15(8-18(21)22)19(17(9-16)26-12-24-2)14-5-3-4-13(6-14)10-20/h3-7,9-10H,8,11-12H2,1-2H3,(H,21,22) |
| InChIKey | PKMSIUUMCRCLQF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|