C27H30BrNO7 — CID 23146935
2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N-[(2,4-dimethoxyphenyl)methyl]acetamide (PubChem CID 23146935) has the molecular formula C27H30BrNO7 and a molecular weight of 560.44 g/mol. Its IUPAC name is 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N-[(2,4-dimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N-[(2,4-dimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 23146935 |
| Molecular Formula | C27H30BrNO7 |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | 2-[2-bromo-3,5-bis(methoxymethoxy)-6-phenylphenyl]-N-[(2,4-dimethoxyphenyl)methyl]acetamide |
| SMILES | COCOc1cc(OCOC)c(-c2ccccc2)c(CC(=O)NCc2ccc(OC)cc2OC)c1Br |
| InChI | InChI=1S/C27H30BrNO7/c1-31-16-35-23-14-24(36-17-32-2)27(28)21(26(23)18-8-6-5-7-9-18)13-25(30)29-15-19-10-11-20(33-3)12-22(19)34-4/h5-12,14H,13,15-17H2,1-4H3,(H,29,30) |
| InChIKey | UTNSPULBMFUVPZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|