C22H28O7 — CID 23146920
2-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethoxy]acetic acid (PubChem CID 23146920) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is 2-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 23146920 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2-[2-[2-ethyl-3,5-bis(methoxymethoxy)-6-phenylphenyl]ethoxy]acetic acid |
| SMILES | CCc1c(OCOC)cc(OCOC)c(-c2ccccc2)c1CCOCC(=O)O |
| InChI | InChI=1S/C22H28O7/c1-4-17-18(10-11-27-13-21(23)24)22(16-8-6-5-7-9-16)20(29-15-26-3)12-19(17)28-14-25-2/h5-9,12H,4,10-11,13-15H2,1-3H3,(H,23,24) |
| InChIKey | BHOFQXNCISZOMN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|