C23H26O9 — CID 23146933
methyl 3-[3-ethyl-4,6-bis(methoxycarbonyloxy)-2-(2-methoxyethyl)phenyl]benzoate (PubChem CID 23146933) has the molecular formula C23H26O9 and a molecular weight of 446.45 g/mol. Its IUPAC name is methyl 3-[3-ethyl-4,6-bis(methoxycarbonyloxy)-2-(2-methoxyethyl)phenyl]benzoate.
| Compound Name | methyl 3-[3-ethyl-4,6-bis(methoxycarbonyloxy)-2-(2-methoxyethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 23146933 |
| Molecular Formula | C23H26O9 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | methyl 3-[3-ethyl-4,6-bis(methoxycarbonyloxy)-2-(2-methoxyethyl)phenyl]benzoate |
| SMILES | CCc1c(OC(=O)OC)cc(OC(=O)OC)c(-c2cccc(C(=O)OC)c2)c1CCOC |
| InChI | InChI=1S/C23H26O9/c1-6-16-17(10-11-27-2)20(14-8-7-9-15(12-14)21(24)28-3)19(32-23(26)30-5)13-18(16)31-22(25)29-4/h7-9,12-13H,6,10-11H2,1-5H3 |
| InChIKey | XTLJQPNELMAVMM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|