C30H31NO6S — CID 123885762
5-[4-[[(1R)-4-[4-(2-ethoxyethoxy)-2,6-dimethylphenoxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1-oxo-1,2-thiazol-3-one (PubChem CID 123885762) has the molecular formula C30H31NO6S and a molecular weight of 533.65 g/mol. Its IUPAC name is 5-[4-[[(1R)-4-[4-(2-ethoxyethoxy)-2,6-dimethylphenoxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1-oxo-1,2-thiazol-3-one.
| Compound Name | 5-[4-[[(1R)-4-[4-(2-ethoxyethoxy)-2,6-dimethylphenoxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1-oxo-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 123885762 |
| Molecular Formula | C30H31NO6S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 5-[4-[[(1R)-4-[4-(2-ethoxyethoxy)-2,6-dimethylphenoxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1-oxo-1,2-thiazol-3-one |
| SMILES | CCOCCOc1cc(C)c(Oc2cccc3c2CC[C@H]3Oc2ccc(C3=CC(=O)NS3=O)cc2)c(C)c1 |
| InChI | InChI=1S/C30H31NO6S/c1-4-34-14-15-35-23-16-19(2)30(20(3)17-23)37-26-7-5-6-24-25(26)12-13-27(24)36-22-10-8-21(9-11-22)28-18-29(32)31-38(28)33/h5-11,16-18,27H,4,12-15H2,1-3H3,(H,31,32)/t27-,38?/m1/s1 |
| InChIKey | RKPPSCHESBHKPN-FFTVHEIDSA-N |
| XLogP | 5.71 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|