C27H27NO6S — CID 42602320
5-[[4-[[3-[2-(hydroxymethyl)-4-(3-hydroxypropoxy)phenyl]phenyl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 42602320) has the molecular formula C27H27NO6S and a molecular weight of 493.58 g/mol. Its IUPAC name is 5-[[4-[[3-[2-(hydroxymethyl)-4-(3-hydroxypropoxy)phenyl]phenyl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[[3-[2-(hydroxymethyl)-4-(3-hydroxypropoxy)phenyl]phenyl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 42602320 |
| Molecular Formula | C27H27NO6S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 5-[[4-[[3-[2-(hydroxymethyl)-4-(3-hydroxypropoxy)phenyl]phenyl]methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc(OCc3cccc(-c4ccc(OCCCO)cc4CO)c3)cc2)S1 |
| InChI | InChI=1S/C27H27NO6S/c29-11-2-12-33-23-9-10-24(21(15-23)16-30)20-4-1-3-19(13-20)17-34-22-7-5-18(6-8-22)14-25-26(31)28-27(32)35-25/h1,3-10,13,15,25,29-30H,2,11-12,14,16-17H2,(H,28,31,32) |
| InChIKey | CEJYVAHHNHOQTL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|