C36H42N2O4 — CID 155657592
ethyl (2R,3S,4R)-8-[[3-[4-(4-cyano-4-methylpentoxy)-2,6-dimethylphenyl]phenyl]methoxy]-10-ethyl-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate (PubChem CID 155657592) has the molecular formula C36H42N2O4 and a molecular weight of 566.74 g/mol. Its IUPAC name is ethyl (2R,3S,4R)-8-[[3-[4-(4-cyano-4-methylpentoxy)-2,6-dimethylphenyl]phenyl]methoxy]-10-ethyl-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate.
| Compound Name | ethyl (2R,3S,4R)-8-[[3-[4-(4-cyano-4-methylpentoxy)-2,6-dimethylphenyl]phenyl]methoxy]-10-ethyl-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate |
|---|---|
| PubChem CID | 155657592 |
| Molecular Formula | C36H42N2O4 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | ethyl (2R,3S,4R)-8-[[3-[4-(4-cyano-4-methylpentoxy)-2,6-dimethylphenyl]phenyl]methoxy]-10-ethyl-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2Cc3cc(OCc4cccc(-c5c(C)cc(OCCCC(C)(C)C#N)cc5C)c4)nc(CC)c3[C@H]21 |
| InChI | InChI=1S/C36H42N2O4/c1-7-29-32-26(18-28-33(32)34(28)35(39)40-8-2)19-30(38-29)42-20-24-11-9-12-25(17-24)31-22(3)15-27(16-23(31)4)41-14-10-13-36(5,6)21-37/h9,11-12,15-17,19,28,33-34H,7-8,10,13-14,18,20H2,1-6H3/t28-,33+,34+/m1/s1 |
| InChIKey | YZUKVSRJKRQEMB-AFAVSPFMSA-N |
| XLogP | 7.66 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|