C30H29F2NO4 — CID 123468116
8-[[3-[4-[(3,3-difluorocyclobutyl)methoxy]-2,6-dimethylphenyl]phenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid (PubChem CID 123468116) has the molecular formula C30H29F2NO4 and a molecular weight of 505.56 g/mol. Its IUPAC name is 8-[[3-[4-[(3,3-difluorocyclobutyl)methoxy]-2,6-dimethylphenyl]phenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid.
| Compound Name | 8-[[3-[4-[(3,3-difluorocyclobutyl)methoxy]-2,6-dimethylphenyl]phenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid |
|---|---|
| PubChem CID | 123468116 |
| Molecular Formula | C30H29F2NO4 |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 8-[[3-[4-[(3,3-difluorocyclobutyl)methoxy]-2,6-dimethylphenyl]phenyl]methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene-3-carboxylic acid |
| SMILES | Cc1cc(OCC2CC(F)(F)C2)cc(C)c1-c1cccc(COc2cc3c(cn2)C2C(C3)C2C(=O)O)c1 |
| InChI | InChI=1S/C30H29F2NO4/c1-16-6-22(36-15-19-11-30(31,32)12-19)7-17(2)26(16)20-5-3-4-18(8-20)14-37-25-10-21-9-23-27(24(21)13-33-25)28(23)29(34)35/h3-8,10,13,19,23,27-28H,9,11-12,14-15H2,1-2H3,(H,34,35) |
| InChIKey | YEMOSXMTAPZYNF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |