C21H25BN2O5 — CID 156594455
methyl 4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoylamino]benzoate (PubChem CID 156594455) has the molecular formula C21H25BN2O5 and a molecular weight of 396.25 g/mol. Its IUPAC name is methyl 4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoylamino]benzoate.
| Compound Name | methyl 4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 156594455 |
| Molecular Formula | C21H25BN2O5 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | methyl 4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Nc2cccc(B3OC(C)(C)C(C)(C)O3)c2)cc1 |
| InChI | InChI=1S/C21H25BN2O5/c1-20(2)21(3,4)29-22(28-20)15-7-6-8-17(13-15)24-19(26)23-16-11-9-14(10-12-16)18(25)27-5/h6-13H,1-5H3,(H2,23,24,26) |
| InChIKey | CGNDRUKHLXJPAC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|