C23H24BrClFNO4 — CID 166749143
tert-butyl 3-(4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl)morpholine-4-carboxylate (PubChem CID 166749143) has the molecular formula C23H24BrClFNO4 and a molecular weight of 512.80 g/mol. Its IUPAC name is tert-butyl 3-(4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-(4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 166749143 |
| Molecular Formula | C23H24BrClFNO4 |
| Molecular Weight | 512.80 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | tert-butyl 3-(4-bromo-5-chloro-6-fluoro-2-phenyl-3H-1-benzofuran-2-yl)morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1C1(c2ccccc2)Cc2c(cc(F)c(Cl)c2Br)O1 |
| InChI | InChI=1S/C23H24BrClFNO4/c1-22(2,3)31-21(28)27-9-10-29-13-18(27)23(14-7-5-4-6-8-14)12-15-17(30-23)11-16(26)20(25)19(15)24/h4-8,11,18H,9-10,12-13H2,1-3H3 |
| InChIKey | HCBWKNVREVRNSQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.80 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|