C29H37BFNO5 — CID 176770334
tert-butyl (2S)-2-[(2S)-6-fluoro-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1-benzofuran-2-yl]pyrrolidine-1-carboxylate (PubChem CID 176770334) has the molecular formula C29H37BFNO5 and a molecular weight of 509.43 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2S)-6-fluoro-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1-benzofuran-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2S)-6-fluoro-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1-benzofuran-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 176770334 |
| Molecular Formula | C29H37BFNO5 |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | tert-butyl (2S)-2-[(2S)-6-fluoro-2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1-benzofuran-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1[C@@]1(c2ccccc2)Cc2c(cc(F)cc2B2OC(C)(C)C(C)(C)O2)O1 |
| InChI | InChI=1S/C29H37BFNO5/c1-26(2,3)35-25(33)32-15-11-14-24(32)29(19-12-9-8-10-13-19)18-21-22(16-20(31)17-23(21)34-29)30-36-27(4,5)28(6,7)37-30/h8-10,12-13,16-17,24H,11,14-15,18H2,1-7H3/t24-,29-/m0/s1 |
| InChIKey | FKPHSKWCQCZBOF-OUTSHDOLSA-N |
| XLogP | 5.35 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|