C24H36BFN2O5 — CID 170456807
tert-butyl (2S)-4-[2-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]-2-methylpiperazine-1-carboxylate (PubChem CID 170456807) has the molecular formula C24H36BFN2O5 and a molecular weight of 462.37 g/mol. Its IUPAC name is tert-butyl (2S)-4-[2-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-[2-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 170456807 |
| Molecular Formula | C24H36BFN2O5 |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | tert-butyl (2S)-4-[2-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetyl]-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)Cc2ccc(F)cc2B2OC(C)(C)C(C)(C)O2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H36BFN2O5/c1-16-15-27(11-12-28(16)21(30)31-22(2,3)4)20(29)13-17-9-10-18(26)14-19(17)25-32-23(5,6)24(7,8)33-25/h9-10,14,16H,11-13,15H2,1-8H3/t16-/m0/s1 |
| InChIKey | IBGUXFMYQVBYSM-INIZCTEOSA-N |
| XLogP | 3.14 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|