C16H18F2N2O6 — CID 118238044
4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4-nitrophenyl)pyrrolidine-2-carboxylic acid (PubChem CID 118238044) has the molecular formula C16H18F2N2O6 and a molecular weight of 372.32 g/mol. Its IUPAC name is 4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4-nitrophenyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4-nitrophenyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 118238044 |
| Molecular Formula | C16H18F2N2O6 |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4-nitrophenyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(F)CC1(C(=O)O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H18F2N2O6/c1-14(2,3)26-13(23)19-9-15(17,18)8-16(19,12(21)22)10-4-6-11(7-5-10)20(24)25/h4-7H,8-9H2,1-3H3,(H,21,22) |
| InChIKey | XLOAYRFKXBDINB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|