C17H20F2N2O4 — CID 170727372
tert-butyl 6,6-difluoro-5-(4-nitrophenyl)-2-azabicyclo[3.1.1]heptane-2-carboxylate (PubChem CID 170727372) has the molecular formula C17H20F2N2O4 and a molecular weight of 354.35 g/mol. Its IUPAC name is tert-butyl 6,6-difluoro-5-(4-nitrophenyl)-2-azabicyclo[3.1.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 6,6-difluoro-5-(4-nitrophenyl)-2-azabicyclo[3.1.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 170727372 |
| Molecular Formula | C17H20F2N2O4 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | tert-butyl 6,6-difluoro-5-(4-nitrophenyl)-2-azabicyclo[3.1.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(c3ccc([N+](=O)[O-])cc3)CC1C2(F)F |
| InChI | InChI=1S/C17H20F2N2O4/c1-15(2,3)25-14(22)20-9-8-16(10-13(20)17(16,18)19)11-4-6-12(7-5-11)21(23)24/h4-7,13H,8-10H2,1-3H3 |
| InChIKey | JKHQZMCBRIOXJY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|