C17H21BrF2N2O5 — CID 177197205
tert-butyl 2-[(2-bromo-4-nitrophenoxy)methyl]-4,4-difluoropiperidine-1-carboxylate (PubChem CID 177197205) has the molecular formula C17H21BrF2N2O5 and a molecular weight of 451.26 g/mol. Its IUPAC name is tert-butyl 2-[(2-bromo-4-nitrophenoxy)methyl]-4,4-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(2-bromo-4-nitrophenoxy)methyl]-4,4-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 177197205 |
| Molecular Formula | C17H21BrF2N2O5 |
| Molecular Weight | 451.26 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | tert-butyl 2-[(2-bromo-4-nitrophenoxy)methyl]-4,4-difluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(F)CC1COc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C17H21BrF2N2O5/c1-16(2,3)27-15(23)21-7-6-17(19,20)9-12(21)10-26-14-5-4-11(22(24)25)8-13(14)18/h4-5,8,12H,6-7,9-10H2,1-3H3 |
| InChIKey | MUWRHZWJOCJVHA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|