C16H28N4O4 — CID 143492483
tert-butyl 4-amino-3-(N-ethoxycarbonyl-N'-methylcarbamimidoyl)-5,5-dimethyl-2H-pyrrole-1-carboxylate (PubChem CID 143492483) has the molecular formula C16H28N4O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is tert-butyl 4-amino-3-(N-ethoxycarbonyl-N'-methylcarbamimidoyl)-5,5-dimethyl-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl 4-amino-3-(N-ethoxycarbonyl-N'-methylcarbamimidoyl)-5,5-dimethyl-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 143492483 |
| Molecular Formula | C16H28N4O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | tert-butyl 4-amino-3-(N-ethoxycarbonyl-N'-methylcarbamimidoyl)-5,5-dimethyl-2H-pyrrole-1-carboxylate |
| SMILES | CCOC(=O)N/C(=N\C)C1=C(N)C(C)(C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H28N4O4/c1-8-23-13(21)19-12(18-7)10-9-20(16(5,6)11(10)17)14(22)24-15(2,3)4/h8-9,17H2,1-7H3,(H,18,19,21) |
| InChIKey | IHWLTBQJVRZCHD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|