C12H25ClN6O2 — CID 161326075
tert-butyl 3-amino-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate;hydrazine;hydrochloride (PubChem CID 161326075) has the molecular formula C12H25ClN6O2 and a molecular weight of 320.83 g/mol. Its IUPAC name is tert-butyl 3-amino-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate;hydrazine;hydrochloride.
| Compound Name | tert-butyl 3-amino-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate;hydrazine;hydrochloride |
|---|---|
| PubChem CID | 161326075 |
| Molecular Formula | C12H25ClN6O2 |
| Molecular Weight | 320.83 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | tert-butyl 3-amino-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate;hydrazine;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1Cc2c(N)n[nH]c2C1(C)C.Cl.NN |
| InChI | InChI=1S/C12H20N4O2.ClH.H4N2/c1-11(2,3)18-10(17)16-6-7-8(12(16,4)5)14-15-9(7)13;;1-2/h6H2,1-5H3,(H3,13,14,15);1H;1-2H2 |
| InChIKey | HKNKMQHCCSDMAH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.83 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|