C20H26N5O5+ — CID 140963675
tert-butyl 2,6,6-trimethyl-3-[(3-nitrobenzoyl)amino]-1,4-dihydropyrrolo[3,4-d]pyrazol-2-ium-5-carboxylate (PubChem CID 140963675) has the molecular formula C20H26N5O5+ and a molecular weight of 416.46 g/mol. Its IUPAC name is tert-butyl 2,6,6-trimethyl-3-[(3-nitrobenzoyl)amino]-1,4-dihydropyrrolo[3,4-d]pyrazol-2-ium-5-carboxylate.
| Compound Name | tert-butyl 2,6,6-trimethyl-3-[(3-nitrobenzoyl)amino]-1,4-dihydropyrrolo[3,4-d]pyrazol-2-ium-5-carboxylate |
|---|---|
| PubChem CID | 140963675 |
| Molecular Formula | C20H26N5O5+ |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | tert-butyl 2,6,6-trimethyl-3-[(3-nitrobenzoyl)amino]-1,4-dihydropyrrolo[3,4-d]pyrazol-2-ium-5-carboxylate |
| SMILES | C[n+]1[nH]c2c(c1NC(=O)c1cccc([N+](=O)[O-])c1)CN(C(=O)OC(C)(C)C)C2(C)C |
| InChI | InChI=1S/C20H25N5O5/c1-19(2,3)30-18(27)24-11-14-15(20(24,4)5)22-23(6)16(14)21-17(26)12-8-7-9-13(10-12)25(28)29/h7-10H,11H2,1-6H3,(H,21,22,26)/p+1 |
| InChIKey | ZRIXGRWISOCRMP-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|