C31H34N4O8S2 — CID 18910583
6-O-tert-butyl 3-O-ethyl 2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (PubChem CID 18910583) has the molecular formula C31H34N4O8S2 and a molecular weight of 654.77 g/mol. Its IUPAC name is 6-O-tert-butyl 3-O-ethyl 2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate.
| Compound Name | 6-O-tert-butyl 3-O-ethyl 2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 18910583 |
| Molecular Formula | C31H34N4O8S2 |
| Molecular Weight | 654.77 g/mol |
| Exact Mass | 654.18 |
| IUPAC Name | 6-O-tert-butyl 3-O-ethyl 2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)c3cccc([N+](=O)[O-])c3)c2)sc2c1CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C31H34N4O8S2/c1-6-42-29(38)25-23-13-14-34(30(39)43-31(3,4)5)17-24(23)45-28(25)33-26(36)18(2)44-22-12-8-10-20(16-22)32-27(37)19-9-7-11-21(15-19)35(40)41/h7-12,15-16,18H,6,13-14,17H2,1-5H3,(H,32,37)(H,33,36) |
| InChIKey | DHPXHLLEKOOXSS-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.77 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|