C42H46N4O9S2 — CID 19050983
6-O-tert-butyl 3-O-ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (PubChem CID 19050983) has the molecular formula C42H46N4O9S2 and a molecular weight of 814.98 g/mol. Its IUPAC name is 6-O-tert-butyl 3-O-ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate.
| Compound Name | 6-O-tert-butyl 3-O-ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 19050983 |
| Molecular Formula | C42H46N4O9S2 |
| Molecular Weight | 814.98 g/mol |
| Exact Mass | 814.27 |
| IUPAC Name | 6-O-tert-butyl 3-O-ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C\c3cccc(OC)c3OC)NC(=O)c3ccccc3)c2)sc2c1CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C42H46N4O9S2/c1-8-54-40(50)34-30-20-21-46(41(51)55-42(3,4)5)24-33(30)57-39(34)45-36(47)25(2)56-29-18-13-17-28(23-29)43-38(49)31(44-37(48)26-14-10-9-11-15-26)22-27-16-12-19-32(52-6)35(27)53-7/h9-19,22-23,25H,8,20-21,24H2,1-7H3,(H,43,49)(H,44,48)(H,45,47)/b31-22+ |
| InChIKey | MYPGPTJJFPBIEU-DFKUXCBWSA-N |
| XLogP | 7.76 |
| TPSA | 161.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.98 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|