C40H40Cl2N4O7S2 — CID 19050851
6-O-tert-butyl 3-O-ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate (PubChem CID 19050851) has the molecular formula C40H40Cl2N4O7S2 and a molecular weight of 823.82 g/mol. Its IUPAC name is 6-O-tert-butyl 3-O-ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate.
| Compound Name | 6-O-tert-butyl 3-O-ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
|---|---|
| PubChem CID | 19050851 |
| Molecular Formula | C40H40Cl2N4O7S2 |
| Molecular Weight | 823.82 g/mol |
| Exact Mass | 822.17 |
| IUPAC Name | 6-O-tert-butyl 3-O-ethyl 2-[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)/C(=C\c3c(Cl)cccc3Cl)NC(=O)c3ccccc3)c2)sc2c1CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C40H40Cl2N4O7S2/c1-6-52-38(50)33-27-18-19-46(39(51)53-40(3,4)5)22-32(27)55-37(33)45-34(47)23(2)54-26-15-10-14-25(20-26)43-36(49)31(21-28-29(41)16-11-17-30(28)42)44-35(48)24-12-8-7-9-13-24/h7-17,20-21,23H,6,18-19,22H2,1-5H3,(H,43,49)(H,44,48)(H,45,47)/b31-21+ |
| InChIKey | WVLCYAWAFUUMQW-NJZRLIGZSA-N |
| XLogP | 9.05 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.82 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|