C33H32N4O6S2 — CID 18910570
ethyl 6-benzyl-2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (PubChem CID 18910570) has the molecular formula C33H32N4O6S2 and a molecular weight of 644.78 g/mol. Its IUPAC name is ethyl 6-benzyl-2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 6-benzyl-2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 18910570 |
| Molecular Formula | C33H32N4O6S2 |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | ethyl 6-benzyl-2-[2-[3-[(3-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)c3cccc([N+](=O)[O-])c3)c2)sc2c1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C33H32N4O6S2/c1-3-43-33(40)29-27-15-16-36(19-22-9-5-4-6-10-22)20-28(27)45-32(29)35-30(38)21(2)44-26-14-8-12-24(18-26)34-31(39)23-11-7-13-25(17-23)37(41)42/h4-14,17-18,21H,3,15-16,19-20H2,1-2H3,(H,34,39)(H,35,38) |
| InChIKey | UGKWZZDGZDSHSU-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|