C32H30N4O6S2 — CID 18910701
methyl 6-benzyl-2-[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (PubChem CID 18910701) has the molecular formula C32H30N4O6S2 and a molecular weight of 630.75 g/mol. Its IUPAC name is methyl 6-benzyl-2-[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | methyl 6-benzyl-2-[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 18910701 |
| Molecular Formula | C32H30N4O6S2 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | methyl 6-benzyl-2-[2-[3-[(4-nitrobenzoyl)amino]phenyl]sulfanylpropanoylamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(C)Sc2cccc(NC(=O)c3ccc([N+](=O)[O-])cc3)c2)sc2c1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C32H30N4O6S2/c1-20(43-25-10-6-9-23(17-25)33-30(38)22-11-13-24(14-12-22)36(40)41)29(37)34-31-28(32(39)42-2)26-15-16-35(19-27(26)44-31)18-21-7-4-3-5-8-21/h3-14,17,20H,15-16,18-19H2,1-2H3,(H,33,38)(H,34,37) |
| InChIKey | JHOIISAUCVOKIO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|