C21H25N7O7 — CID 91506997
6,6-dimethyl-3-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-4H-pyrrolo[3,4-c]pyrazole-2,5-dicarboxylic acid (PubChem CID 91506997) has the molecular formula C21H25N7O7 and a molecular weight of 487.47 g/mol. Its IUPAC name is 6,6-dimethyl-3-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-4H-pyrrolo[3,4-c]pyrazole-2,5-dicarboxylic acid.
| Compound Name | 6,6-dimethyl-3-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-4H-pyrrolo[3,4-c]pyrazole-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 91506997 |
| Molecular Formula | C21H25N7O7 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 6,6-dimethyl-3-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]-4H-pyrrolo[3,4-c]pyrazole-2,5-dicarboxylic acid |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3c4c(nn3C(=O)O)C(C)(C)N(C(=O)O)C4)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H25N7O7/c1-21(2)16-13(11-26(21)19(30)31)17(27(23-16)20(32)33)22-18(29)12-4-5-14(15(10-12)28(34)35)25-8-6-24(3)7-9-25/h4-5,10H,6-9,11H2,1-3H3,(H,22,29)(H,30,31)(H,32,33) |
| InChIKey | TWNSPQPTRXHGFP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 174.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|