C20H23N5O6 — CID 108740637
4-acetyl-5-methyl-2-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]furan-3-carboxamide (PubChem CID 108740637) has the molecular formula C20H23N5O6 and a molecular weight of 429.43 g/mol. Its IUPAC name is 4-acetyl-5-methyl-2-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]furan-3-carboxamide.
| Compound Name | 4-acetyl-5-methyl-2-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]furan-3-carboxamide |
|---|---|
| PubChem CID | 108740637 |
| Molecular Formula | C20H23N5O6 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 4-acetyl-5-methyl-2-[[4-(4-methylpiperazin-1-yl)-3-nitrobenzoyl]amino]furan-3-carboxamide |
| SMILES | CC(=O)c1c(C)oc(NC(=O)c2ccc(N3CCN(C)CC3)c([N+](=O)[O-])c2)c1C(N)=O |
| InChI | InChI=1S/C20H23N5O6/c1-11(26)16-12(2)31-20(17(16)18(21)27)22-19(28)13-4-5-14(15(10-13)25(29)30)24-8-6-23(3)7-9-24/h4-5,10H,6-9H2,1-3H3,(H2,21,27)(H,22,28) |
| InChIKey | PPJNJJCNYXIDBN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 152.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|