C29H24N4O3 — CID 4227534
ethyl 5-[(3-methyl-2-phenylquinoline-4-carbonyl)amino]-1-phenylpyrazole-4-carboxylate (PubChem CID 4227534) has the molecular formula C29H24N4O3 and a molecular weight of 476.54 g/mol. Its IUPAC name is ethyl 5-[(3-methyl-2-phenylquinoline-4-carbonyl)amino]-1-phenylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(3-methyl-2-phenylquinoline-4-carbonyl)amino]-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 4227534 |
| Molecular Formula | C29H24N4O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | ethyl 5-[(3-methyl-2-phenylquinoline-4-carbonyl)amino]-1-phenylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1NC(=O)c1c(C)c(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C29H24N4O3/c1-3-36-29(35)23-18-30-33(21-14-8-5-9-15-21)27(23)32-28(34)25-19(2)26(20-12-6-4-7-13-20)31-24-17-11-10-16-22(24)25/h4-18H,3H2,1-2H3,(H,32,34) |
| InChIKey | GWZXXSSSYOYFMJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |