C20H16ClN5O2 — CID 108775869
ethyl 5-[(3-chloroquinoxalin-2-yl)amino]-1-phenylpyrazole-4-carboxylate (PubChem CID 108775869) has the molecular formula C20H16ClN5O2 and a molecular weight of 393.83 g/mol. Its IUPAC name is ethyl 5-[(3-chloroquinoxalin-2-yl)amino]-1-phenylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(3-chloroquinoxalin-2-yl)amino]-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108775869 |
| Molecular Formula | C20H16ClN5O2 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | ethyl 5-[(3-chloroquinoxalin-2-yl)amino]-1-phenylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1Nc1nc2ccccc2nc1Cl |
| InChI | InChI=1S/C20H16ClN5O2/c1-2-28-20(27)14-12-22-26(13-8-4-3-5-9-13)19(14)25-18-17(21)23-15-10-6-7-11-16(15)24-18/h3-12H,2H2,1H3,(H,24,25) |
| InChIKey | DZWBRBUWBWQREM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |