C19H15Cl2N3O3 — CID 4547350
ethyl 5-[(2,4-dichlorobenzoyl)amino]-1-phenylpyrazole-4-carboxylate (PubChem CID 4547350) has the molecular formula C19H15Cl2N3O3 and a molecular weight of 404.25 g/mol. Its IUPAC name is ethyl 5-[(2,4-dichlorobenzoyl)amino]-1-phenylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(2,4-dichlorobenzoyl)amino]-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 4547350 |
| Molecular Formula | C19H15Cl2N3O3 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | ethyl 5-[(2,4-dichlorobenzoyl)amino]-1-phenylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl2N3O3/c1-2-27-19(26)15-11-22-24(13-6-4-3-5-7-13)17(15)23-18(25)14-9-8-12(20)10-16(14)21/h3-11H,2H2,1H3,(H,23,25) |
| InChIKey | HQLJMNBQNUVZMW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |