C20H17N5O3S — CID 19509067
ethyl 1-phenyl-5-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]pyrazole-4-carboxylate (PubChem CID 19509067) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is ethyl 1-phenyl-5-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-phenyl-5-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 19509067 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | ethyl 1-phenyl-5-[(5-thiophen-2-yl-1H-pyrazole-3-carbonyl)amino]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1NC(=O)c1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C20H17N5O3S/c1-2-28-20(27)14-12-21-25(13-7-4-3-5-8-13)18(14)22-19(26)16-11-15(23-24-16)17-9-6-10-29-17/h3-12H,2H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | ZFLGCDCAMRSBOO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |